C21H20N4O3S — CID 1083225
5-(benzenesulfonyl)-7-[(2S)-butan-2-yl]-6-imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one (PubChem CID 1083225) has the molecular formula C21H20N4O3S and a molecular weight of 408.48 g/mol. Its IUPAC name is 5-(benzenesulfonyl)-7-[(2S)-butan-2-yl]-6-imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one.
| Compound Name | 5-(benzenesulfonyl)-7-[(2S)-butan-2-yl]-6-imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one |
|---|---|
| PubChem CID | 1083225 |
| Molecular Formula | C21H20N4O3S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 5-(benzenesulfonyl)-7-[(2S)-butan-2-yl]-6-imino-1,7,9-triazatricyclo[8.4.0.03,8]tetradeca-3(8),4,9,11,13-pentaen-2-one |
| SMILES | [H]/N=c1/c(S(=O)(=O)c2ccccc2)cc2c(=O)n3ccccc3nc2n1[C@@H](C)CC |
| InChI | InChI=1S/C21H20N4O3S/c1-3-14(2)25-19(22)17(29(27,28)15-9-5-4-6-10-15)13-16-20(25)23-18-11-7-8-12-24(18)21(16)26/h4-14,22H,3H2,1-2H3/b22-19-/t14-/m0/s1 |
| InChIKey | NKXBQBNUZDGBIQ-RPIBDXEDSA-N |
| XLogP | 2.93 |
| TPSA | 97.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|