C16H30N2O3SSi — CID 10832273
tert-butyl-[5-(5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-2-yl)pentoxy]-dimethylsilane (PubChem CID 10832273) has the molecular formula C16H30N2O3SSi and a molecular weight of 358.58 g/mol. Its IUPAC name is tert-butyl-[5-(5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-2-yl)pentoxy]-dimethylsilane.
| Compound Name | tert-butyl-[5-(5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-2-yl)pentoxy]-dimethylsilane |
|---|---|
| PubChem CID | 10832273 |
| Molecular Formula | C16H30N2O3SSi |
| Molecular Weight | 358.58 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | tert-butyl-[5-(5,5-dioxo-4,6-dihydrothieno[3,4-c]pyrazol-2-yl)pentoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCCCCn1cc2c(n1)CS(=O)(=O)C2 |
| InChI | InChI=1S/C16H30N2O3SSi/c1-16(2,3)23(4,5)21-10-8-6-7-9-18-11-14-12-22(19,20)13-15(14)17-18/h11H,6-10,12-13H2,1-5H3 |
| InChIKey | KFYXYPWIZHUVDV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.58 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|