C24H41NO — CID 10832336
(5Z,8Z,11Z,14Z)-N-butan-2-ylicosa-5,8,11,14-tetraenamide (PubChem CID 10832336) has the molecular formula C24H41NO and a molecular weight of 359.60 g/mol. Its IUPAC name is (5Z,8Z,11Z,14Z)-N-butan-2-ylicosa-5,8,11,14-tetraenamide.
| Compound Name | (5Z,8Z,11Z,14Z)-N-butan-2-ylicosa-5,8,11,14-tetraenamide |
|---|---|
| PubChem CID | 10832336 |
| Molecular Formula | C24H41NO |
| Molecular Weight | 359.60 g/mol |
| Exact Mass | 359.32 |
| IUPAC Name | (5Z,8Z,11Z,14Z)-N-butan-2-ylicosa-5,8,11,14-tetraenamide |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CCCC(=O)NC(C)CC |
| InChI | InChI=1S/C24H41NO/c1-4-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-24(26)25-23(3)5-2/h9-10,12-13,15-16,18-19,23H,4-8,11,14,17,20-22H2,1-3H3,(H,25,26)/b10-9-,13-12-,16-15-,19-18- |
| InChIKey | FSBHLSINBYYIIF-SNPVRQPZSA-N |
| XLogP | 7.05 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.60 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|