C23H24N2O2 — CID 10832383
6-[4-(4-benzylpiperidin-1-yl)but-1-ynyl]-3H-1,3-benzoxazol-2-one (PubChem CID 10832383) has the molecular formula C23H24N2O2 and a molecular weight of 360.46 g/mol. Its IUPAC name is 6-[4-(4-benzylpiperidin-1-yl)but-1-ynyl]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-[4-(4-benzylpiperidin-1-yl)but-1-ynyl]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 10832383 |
| Molecular Formula | C23H24N2O2 |
| Molecular Weight | 360.46 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | 6-[4-(4-benzylpiperidin-1-yl)but-1-ynyl]-3H-1,3-benzoxazol-2-one |
| SMILES | O=c1[nH]c2ccc(C#CCCN3CCC(Cc4ccccc4)CC3)cc2o1 |
| InChI | InChI=1S/C23H24N2O2/c26-23-24-21-10-9-19(17-22(21)27-23)8-4-5-13-25-14-11-20(12-15-25)16-18-6-2-1-3-7-18/h1-3,6-7,9-10,17,20H,5,11-16H2,(H,24,26) |
| InChIKey | XSDFIKYRYXOSHQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 49.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.46 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|