C22H23NO4 — CID 10832664
diethyl 1-methyl-4-phenyl-2H-quinoline-2,3-dicarboxylate (PubChem CID 10832664) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is diethyl 1-methyl-4-phenyl-2H-quinoline-2,3-dicarboxylate.
| Compound Name | diethyl 1-methyl-4-phenyl-2H-quinoline-2,3-dicarboxylate |
|---|---|
| PubChem CID | 10832664 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | diethyl 1-methyl-4-phenyl-2H-quinoline-2,3-dicarboxylate |
| SMILES | CCOC(=O)C1=C(c2ccccc2)c2ccccc2N(C)C1C(=O)OCC |
| InChI | InChI=1S/C22H23NO4/c1-4-26-21(24)19-18(15-11-7-6-8-12-15)16-13-9-10-14-17(16)23(3)20(19)22(25)27-5-2/h6-14,20H,4-5H2,1-3H3 |
| InChIKey | DFXFZPXXJBFRPN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |