About 4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-methyl-1-triethylsilyloxybutan-2-ol
4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-methyl-1-triethylsilyloxybutan-2-ol (PubChem CID 10832997) has the molecular formula C20H38O4Si
and a molecular weight of 370.61 g/mol. Its IUPAC name is 4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-methyl-1-triethylsilyloxybutan-2-ol.
Molecular Properties
| Compound Name | 4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-methyl-1-triethylsilyloxybutan-2-ol |
| PubChem CID | 10832997 |
| Molecular Formula | C20H38O4Si |
| Molecular Weight | 370.61 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-methyl-1-triethylsilyloxybutan-2-ol |
| SMILES | CC[Si](CC)(CC)OCC(C)(O)CCC1CC=CC2(CCCCO2)O1 |
| InChI | InChI=1S/C20H38O4Si/c1-5-25(6-2,7-3)23-17-19(4,21)15-12-18-11-10-14-20(24-18)13-8-9-16-22-20/h10,14,18,21H,5-9,11-13,15-17H2,1-4H3 |
| InChIKey | PPDWBCXHFSRTFL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-methyl-1-triethylsilyloxybutan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-methyl-1-triethylsilyloxybutan-2-ol?
The IUPAC name of 4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-methyl-1-triethylsilyloxybutan-2-ol (CID 10832997) is 4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-methyl-1-triethylsilyloxybutan-2-ol.
What is the SMILES notation for 4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-methyl-1-triethylsilyloxybutan-2-ol?
The canonical SMILES for 4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-methyl-1-triethylsilyloxybutan-2-ol is CC[Si](CC)(CC)OCC(C)(O)CCC1CC=CC2(CCCCO2)O1.
What is the InChIKey of 4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-methyl-1-triethylsilyloxybutan-2-ol?
The InChIKey is PPDWBCXHFSRTFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H38O4Si/c1-5-25(6-2,7-3)23-17-19(4,21)15-12-18-11-10-14-20(24-18)13-8-9-16-22-20/h10,14,18,21H,5-9,11-13,15-17H2,1-4H3.
What are the key properties of 4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-methyl-1-triethylsilyloxybutan-2-ol?
4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-methyl-1-triethylsilyloxybutan-2-ol has a molecular weight of 370.61 g/mol, XLogP of 4.78, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1,7-dioxaspiro[5.5]undec-4-en-2-yl)-2-methyl-1-triethylsilyloxybutan-2-ol is sourced from PubChem (CID 10832997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).