C18H31NO7 — CID 10833153
(2R,3S)-N,N-diethyl-3-[(4R,5S)-5-[(4R,5R)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]oxirane-2-carboxamide (PubChem CID 10833153) has the molecular formula C18H31NO7 and a molecular weight of 373.45 g/mol. Its IUPAC name is (2R,3S)-N,N-diethyl-3-[(4R,5S)-5-[(4R,5R)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]oxirane-2-carboxamide.
| Compound Name | (2R,3S)-N,N-diethyl-3-[(4R,5S)-5-[(4R,5R)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]oxirane-2-carboxamide |
|---|---|
| PubChem CID | 10833153 |
| Molecular Formula | C18H31NO7 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.21 |
| IUPAC Name | (2R,3S)-N,N-diethyl-3-[(4R,5S)-5-[(4R,5R)-5-hydroxy-2,2-dimethyl-1,3-dioxan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]oxirane-2-carboxamide |
| SMILES | CCN(CC)C(=O)[C@@H]1O[C@H]1[C@H]1OC(C)(C)O[C@H]1[C@@H]1OC(C)(C)OC[C@H]1O |
| InChI | InChI=1S/C18H31NO7/c1-7-19(8-2)16(21)15-12(23-15)14-13(25-18(5,6)26-14)11-10(20)9-22-17(3,4)24-11/h10-15,20H,7-9H2,1-6H3/t10-,11-,12+,13+,14-,15-/m1/s1 |
| InChIKey | XTDURPFOGSBDTO-PEZGRIKUSA-N |
| XLogP | 0.65 |
| TPSA | 89.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|