C22H22N4S — CID 10833258
8-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene (PubChem CID 10833258) has the molecular formula C22H22N4S and a molecular weight of 374.51 g/mol. Its IUPAC name is 8-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene.
| Compound Name | 8-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
|---|---|
| PubChem CID | 10833258 |
| Molecular Formula | C22H22N4S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 8-[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]-3-thia-1,7-diazatricyclo[7.3.0.02,6]dodeca-2(6),4,7,9,11-pentaene |
| SMILES | C(=C/c1ccccc1)\CN1CCN(c2nc3ccsc3n3cccc23)CC1 |
| InChI | InChI=1S/C22H22N4S/c1-2-6-18(7-3-1)8-4-11-24-13-15-25(16-14-24)21-20-9-5-12-26(20)22-19(23-21)10-17-27-22/h1-10,12,17H,11,13-16H2/b8-4+ |
| InChIKey | DXTRNUSQQPMWSC-XBXARRHUSA-N |
| XLogP | 4.38 |
| TPSA | 23.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |