C16H23BrO5 — CID 10833291
methyl 2-[(3S,3aR,4S,5S,6S,7S,7aR)-5-bromo-6-ethyl-4-hydroxy-3,6-dimethyl-2-oxo-3,3a,4,5,7,7a-hexahydro-1-benzofuran-7-yl]prop-2-enoate (PubChem CID 10833291) has the molecular formula C16H23BrO5 and a molecular weight of 375.26 g/mol. Its IUPAC name is methyl 2-[(3S,3aR,4S,5S,6S,7S,7aR)-5-bromo-6-ethyl-4-hydroxy-3,6-dimethyl-2-oxo-3,3a,4,5,7,7a-hexahydro-1-benzofuran-7-yl]prop-2-enoate.
| Compound Name | methyl 2-[(3S,3aR,4S,5S,6S,7S,7aR)-5-bromo-6-ethyl-4-hydroxy-3,6-dimethyl-2-oxo-3,3a,4,5,7,7a-hexahydro-1-benzofuran-7-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10833291 |
| Molecular Formula | C16H23BrO5 |
| Molecular Weight | 375.26 g/mol |
| Exact Mass | 374.07 |
| IUPAC Name | methyl 2-[(3S,3aR,4S,5S,6S,7S,7aR)-5-bromo-6-ethyl-4-hydroxy-3,6-dimethyl-2-oxo-3,3a,4,5,7,7a-hexahydro-1-benzofuran-7-yl]prop-2-enoate |
| SMILES | C=C(C(=O)OC)[C@@H]1[C@H]2OC(=O)[C@@H](C)[C@@H]2[C@H](O)[C@@H](Br)[C@@]1(C)CC |
| InChI | InChI=1S/C16H23BrO5/c1-6-16(4)10(8(3)14(19)21-5)12-9(11(18)13(16)17)7(2)15(20)22-12/h7,9-13,18H,3,6H2,1-2,4-5H3/t7-,9+,10+,11-,12-,13+,16-/m0/s1 |
| InChIKey | AEVVUSDKTBIMJZ-XBHVNDETSA-N |
| XLogP | 2.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|