C20H34O5Si — CID 10833787
ethyl (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carboxylate (PubChem CID 10833787) has the molecular formula C20H34O5Si and a molecular weight of 382.57 g/mol. Its IUPAC name is ethyl (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carboxylate.
| Compound Name | ethyl (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carboxylate |
|---|---|
| PubChem CID | 10833787 |
| Molecular Formula | C20H34O5Si |
| Molecular Weight | 382.57 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | ethyl (4aR,8aR)-7-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethyl-4-oxo-3,5,8,8a-tetrahydrochromene-4a-carboxylate |
| SMILES | CCOC(=O)[C@]12CC=C(O[Si](C)(C)C(C)(C)C)C[C@H]1OC(C)(C)CC2=O |
| InChI | InChI=1S/C20H34O5Si/c1-9-23-17(22)20-11-10-14(25-26(7,8)18(2,3)4)12-16(20)24-19(5,6)13-15(20)21/h10,16H,9,11-13H2,1-8H3/t16-,20+/m1/s1 |
| InChIKey | NVIWTHKDFAFGFK-UZLBHIALSA-N |
| XLogP | 4.37 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.57 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|