C23H31ClN2O — CID 10834067
4-(8-chloro-7-methoxy-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-N,N-dimethylbutan-1-amine (PubChem CID 10834067) has the molecular formula C23H31ClN2O and a molecular weight of 386.97 g/mol. Its IUPAC name is 4-(8-chloro-7-methoxy-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-N,N-dimethylbutan-1-amine.
| Compound Name | 4-(8-chloro-7-methoxy-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 10834067 |
| Molecular Formula | C23H31ClN2O |
| Molecular Weight | 386.97 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 4-(8-chloro-7-methoxy-5-phenyl-1,2,4,5-tetrahydro-3-benzazepin-3-yl)-N,N-dimethylbutan-1-amine |
| SMILES | COc1cc2c(cc1Cl)CCN(CCCCN(C)C)CC2c1ccccc1 |
| InChI | InChI=1S/C23H31ClN2O/c1-25(2)12-7-8-13-26-14-11-19-15-22(24)23(27-3)16-20(19)21(17-26)18-9-5-4-6-10-18/h4-6,9-10,15-16,21H,7-8,11-14,17H2,1-3H3 |
| InChIKey | WOPDWQCRTGCGSI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.97 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|