C24H24O5 — CID 10834346
ethyl 2-[2-(1,2-dihydroxy-1-phenylethyl)phenoxy]-2-phenylacetate (PubChem CID 10834346) has the molecular formula C24H24O5 and a molecular weight of 392.45 g/mol. Its IUPAC name is ethyl 2-[2-(1,2-dihydroxy-1-phenylethyl)phenoxy]-2-phenylacetate.
| Compound Name | ethyl 2-[2-(1,2-dihydroxy-1-phenylethyl)phenoxy]-2-phenylacetate |
|---|---|
| PubChem CID | 10834346 |
| Molecular Formula | C24H24O5 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | ethyl 2-[2-(1,2-dihydroxy-1-phenylethyl)phenoxy]-2-phenylacetate |
| SMILES | CCOC(=O)C(Oc1ccccc1C(O)(CO)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24O5/c1-2-28-23(26)22(18-11-5-3-6-12-18)29-21-16-10-9-15-20(21)24(27,17-25)19-13-7-4-8-14-19/h3-16,22,25,27H,2,17H2,1H3 |
| InChIKey | RAZDFQBMTJIJIA-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |