C23H28N4S — CID 10834371
3-isothiocyanato-9-[3-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]propyl]carbazole (PubChem CID 10834371) has the molecular formula C23H28N4S and a molecular weight of 392.57 g/mol. Its IUPAC name is 3-isothiocyanato-9-[3-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]propyl]carbazole.
| Compound Name | 3-isothiocyanato-9-[3-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]propyl]carbazole |
|---|---|
| PubChem CID | 10834371 |
| Molecular Formula | C23H28N4S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 3-isothiocyanato-9-[3-[(3R,5S)-3,4,5-trimethylpiperazin-1-yl]propyl]carbazole |
| SMILES | C[C@@H]1CN(CCCn2c3ccccc3c3cc(N=C=S)ccc32)C[C@H](C)N1C |
| InChI | InChI=1S/C23H28N4S/c1-17-14-26(15-18(2)25(17)3)11-6-12-27-22-8-5-4-7-20(22)21-13-19(24-16-28)9-10-23(21)27/h4-5,7-10,13,17-18H,6,11-12,14-15H2,1-3H3/t17-,18+ |
| InChIKey | JEWVQXTWRAAFOV-HDICACEKSA-N |
| XLogP | 4.94 |
| TPSA | 23.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|