C21H16O8 — CID 10834548
5,5',6,6'-tetramethoxy-2,2'-spirobi[indene]-1,1',3,3'-tetrone (PubChem CID 10834548) has the molecular formula C21H16O8 and a molecular weight of 396.35 g/mol. Its IUPAC name is 5,5',6,6'-tetramethoxy-2,2'-spirobi[indene]-1,1',3,3'-tetrone.
| Compound Name | 5,5',6,6'-tetramethoxy-2,2'-spirobi[indene]-1,1',3,3'-tetrone |
|---|---|
| PubChem CID | 10834548 |
| Molecular Formula | C21H16O8 |
| Molecular Weight | 396.35 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | 5,5',6,6'-tetramethoxy-2,2'-spirobi[indene]-1,1',3,3'-tetrone |
| SMILES | COc1cc2c(cc1OC)C(=O)C1(C2=O)C(=O)c2cc(OC)c(OC)cc2C1=O |
| InChI | InChI=1S/C21H16O8/c1-26-13-5-9-10(6-14(13)27-2)18(23)21(17(9)22)19(24)11-7-15(28-3)16(29-4)8-12(11)20(21)25/h5-8H,1-4H3 |
| InChIKey | JQHUHAWPFFPVTE-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|