C18H28N4O6 — CID 10834556
tert-butyl (2R,3Z)-7-azido-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]-8-oxo-2,5,6,7-tetrahydroazocine-1-carboxylate (PubChem CID 10834556) has the molecular formula C18H28N4O6 and a molecular weight of 396.44 g/mol. Its IUPAC name is tert-butyl (2R,3Z)-7-azido-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]-8-oxo-2,5,6,7-tetrahydroazocine-1-carboxylate.
| Compound Name | tert-butyl (2R,3Z)-7-azido-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]-8-oxo-2,5,6,7-tetrahydroazocine-1-carboxylate |
|---|---|
| PubChem CID | 10834556 |
| Molecular Formula | C18H28N4O6 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | tert-butyl (2R,3Z)-7-azido-2-[(2-methylpropan-2-yl)oxycarbonyloxymethyl]-8-oxo-2,5,6,7-tetrahydroazocine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)OC[C@H]1/C=C\CCC(N=[N+]=[N-])C(=O)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N4O6/c1-17(2,3)27-15(24)22-12(11-26-16(25)28-18(4,5)6)9-7-8-10-13(14(22)23)20-21-19/h7,9,12-13H,8,10-11H2,1-6H3/b9-7-/t12-,13?/m1/s1 |
| InChIKey | PZGYMRKXQXCWMQ-OXKCCFPGSA-N |
| XLogP | 4.10 |
| TPSA | 130.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|