C19H18N4O6 — CID 10834663
(Z)-[5-[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]-2-methyl-6-phenylpyrrolo[2,1-e]tetrazol-2-ium-7-ylidene]-methoxymethanolate (PubChem CID 10834663) has the molecular formula C19H18N4O6 and a molecular weight of 398.38 g/mol. Its IUPAC name is (Z)-[5-[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]-2-methyl-6-phenylpyrrolo[2,1-e]tetrazol-2-ium-7-ylidene]-methoxymethanolate.
| Compound Name | (Z)-[5-[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]-2-methyl-6-phenylpyrrolo[2,1-e]tetrazol-2-ium-7-ylidene]-methoxymethanolate |
|---|---|
| PubChem CID | 10834663 |
| Molecular Formula | C19H18N4O6 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (Z)-[5-[(Z)-1,4-dimethoxy-1,4-dioxobut-2-en-2-yl]-2-methyl-6-phenylpyrrolo[2,1-e]tetrazol-2-ium-7-ylidene]-methoxymethanolate |
| SMILES | COC(=O)/C=C(\C(=O)OC)c1c(-c2ccccc2)/c(=C(\[O-])OC)c2n[n+](C)nn12 |
| InChI | InChI=1S/C19H18N4O6/c1-22-20-17-15(19(26)29-4)14(11-8-6-5-7-9-11)16(23(17)21-22)12(18(25)28-3)10-13(24)27-2/h5-10H,1-4H3 |
| InChIKey | RYMSFLPAPLYGBX-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 118.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|