C18H27NO9 — CID 10834880
[(1S,2S,5R,6S)-5,6-diacetyloxy-4-(hydroxymethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-en-1-yl] acetate (PubChem CID 10834880) has the molecular formula C18H27NO9 and a molecular weight of 401.41 g/mol. Its IUPAC name is [(1S,2S,5R,6S)-5,6-diacetyloxy-4-(hydroxymethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-en-1-yl] acetate.
| Compound Name | [(1S,2S,5R,6S)-5,6-diacetyloxy-4-(hydroxymethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 10834880 |
| Molecular Formula | C18H27NO9 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.17 |
| IUPAC Name | [(1S,2S,5R,6S)-5,6-diacetyloxy-4-(hydroxymethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)C(CO)=C[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO9/c1-9(21)25-14-12(8-20)7-13(19-17(24)28-18(4,5)6)15(26-10(2)22)16(14)27-11(3)23/h7,13-16,20H,8H2,1-6H3,(H,19,24)/t13-,14+,15-,16-/m0/s1 |
| InChIKey | VVLCDEQSHTWSIA-FZKCQIBNSA-N |
| XLogP | 0.61 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|