C24H38O3Si — CID 10834973
(4S,5S,6R)-4,6-dimethyl-9-phenylmethoxy-5-triethylsilyloxynon-2-ynal (PubChem CID 10834973) has the molecular formula C24H38O3Si and a molecular weight of 402.65 g/mol. Its IUPAC name is (4S,5S,6R)-4,6-dimethyl-9-phenylmethoxy-5-triethylsilyloxynon-2-ynal.
| Compound Name | (4S,5S,6R)-4,6-dimethyl-9-phenylmethoxy-5-triethylsilyloxynon-2-ynal |
|---|---|
| PubChem CID | 10834973 |
| Molecular Formula | C24H38O3Si |
| Molecular Weight | 402.65 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (4S,5S,6R)-4,6-dimethyl-9-phenylmethoxy-5-triethylsilyloxynon-2-ynal |
| SMILES | CC[Si](CC)(CC)O[C@@H]([C@H](C)CCCOCc1ccccc1)[C@@H](C)C#CC=O |
| InChI | InChI=1S/C24H38O3Si/c1-6-28(7-2,8-3)27-24(21(4)14-12-18-25)22(5)15-13-19-26-20-23-16-10-9-11-17-23/h9-11,16-18,21-22,24H,6-8,13,15,19-20H2,1-5H3/t21-,22+,24+/m0/s1 |
| InChIKey | OQKVXDUNPRBHCH-WMTXJRDZSA-N |
| XLogP | 5.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.65 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|