C17H16N4O8 — CID 10835045
6-amino-5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-(2-nitrophenyl)methyl]-5H-pyrimidine-2,4-dione (PubChem CID 10835045) has the molecular formula C17H16N4O8 and a molecular weight of 404.34 g/mol. Its IUPAC name is 6-amino-5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-(2-nitrophenyl)methyl]-5H-pyrimidine-2,4-dione.
| Compound Name | 6-amino-5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-(2-nitrophenyl)methyl]-5H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10835045 |
| Molecular Formula | C17H16N4O8 |
| Molecular Weight | 404.34 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 6-amino-5-[(2,2-dimethyl-4,6-dioxo-1,3-dioxan-5-yl)-(2-nitrophenyl)methyl]-5H-pyrimidine-2,4-dione |
| SMILES | CC1(C)OC(=O)C(C(c2ccccc2[N+](=O)[O-])C2C(=O)NC(=O)N=C2N)C(=O)O1 |
| InChI | InChI=1S/C17H16N4O8/c1-17(2)28-14(23)11(15(24)29-17)9(7-5-3-4-6-8(7)21(26)27)10-12(18)19-16(25)20-13(10)22/h3-6,9-11H,1-2H3,(H3,18,19,20,22,25) |
| InChIKey | IBVJYXDRDOJJQH-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 180.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|