About diethyl (4Z)-4-benzylidene-5,5-dimethyl-2-phenyloxolane-3,3-dicarboxylate
diethyl (4Z)-4-benzylidene-5,5-dimethyl-2-phenyloxolane-3,3-dicarboxylate (PubChem CID 10835291) has the molecular formula C25H28O5
and a molecular weight of 408.49 g/mol. Its IUPAC name is diethyl (4Z)-4-benzylidene-5,5-dimethyl-2-phenyloxolane-3,3-dicarboxylate.
Molecular Properties
| Compound Name | diethyl (4Z)-4-benzylidene-5,5-dimethyl-2-phenyloxolane-3,3-dicarboxylate |
| PubChem CID | 10835291 |
| Molecular Formula | C25H28O5 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | diethyl (4Z)-4-benzylidene-5,5-dimethyl-2-phenyloxolane-3,3-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)/C(=C/c2ccccc2)C(C)(C)OC1c1ccccc1 |
| InChI | InChI=1S/C25H28O5/c1-5-28-22(26)25(23(27)29-6-2)20(17-18-13-9-7-10-14-18)24(3,4)30-21(25)19-15-11-8-12-16-19/h7-17,21H,5-6H2,1-4H3/b20-17+ |
| InChIKey | BVBWLRHISZHLCA-LVZFUZTISA-N |
| XLogP | 4.73 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze diethyl (4Z)-4-benzylidene-5,5-dimethyl-2-phenyloxolane-3,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (4Z)-4-benzylidene-5,5-dimethyl-2-phenyloxolane-3,3-dicarboxylate?
The IUPAC name of diethyl (4Z)-4-benzylidene-5,5-dimethyl-2-phenyloxolane-3,3-dicarboxylate (CID 10835291) is diethyl (4Z)-4-benzylidene-5,5-dimethyl-2-phenyloxolane-3,3-dicarboxylate.
What is the SMILES notation for diethyl (4Z)-4-benzylidene-5,5-dimethyl-2-phenyloxolane-3,3-dicarboxylate?
The canonical SMILES for diethyl (4Z)-4-benzylidene-5,5-dimethyl-2-phenyloxolane-3,3-dicarboxylate is CCOC(=O)C1(C(=O)OCC)/C(=C/c2ccccc2)C(C)(C)OC1c1ccccc1.
What is the InChIKey of diethyl (4Z)-4-benzylidene-5,5-dimethyl-2-phenyloxolane-3,3-dicarboxylate?
The InChIKey is BVBWLRHISZHLCA-LVZFUZTISA-N. The full InChI is InChI=1S/C25H28O5/c1-5-28-22(26)25(23(27)29-6-2)20(17-18-13-9-7-10-14-18)24(3,4)30-21(25)19-15-11-8-12-16-19/h7-17,21H,5-6H2,1-4H3/b20-17+.
What are the key properties of diethyl (4Z)-4-benzylidene-5,5-dimethyl-2-phenyloxolane-3,3-dicarboxylate?
diethyl (4Z)-4-benzylidene-5,5-dimethyl-2-phenyloxolane-3,3-dicarboxylate has a molecular weight of 408.49 g/mol, XLogP of 4.73, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (4Z)-4-benzylidene-5,5-dimethyl-2-phenyloxolane-3,3-dicarboxylate is sourced from PubChem (CID 10835291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).