C22H38O5Si — CID 10835413
(4S,4'aS,5'R,8'aS)-7'-[[tert-butyl(dimethyl)silyl]oxymethyl]-5'-hydroxy-4',4',8'a-trimethylspiro[1,3-dioxolane-4,8'-2,3,4a,5-tetrahydro-1H-naphthalene]-2-one (PubChem CID 10835413) has the molecular formula C22H38O5Si and a molecular weight of 410.63 g/mol. Its IUPAC name is (4S,4'aS,5'R,8'aS)-7'-[[tert-butyl(dimethyl)silyl]oxymethyl]-5'-hydroxy-4',4',8'a-trimethylspiro[1,3-dioxolane-4,8'-2,3,4a,5-tetrahydro-1H-naphthalene]-2-one.
| Compound Name | (4S,4'aS,5'R,8'aS)-7'-[[tert-butyl(dimethyl)silyl]oxymethyl]-5'-hydroxy-4',4',8'a-trimethylspiro[1,3-dioxolane-4,8'-2,3,4a,5-tetrahydro-1H-naphthalene]-2-one |
|---|---|
| PubChem CID | 10835413 |
| Molecular Formula | C22H38O5Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | (4S,4'aS,5'R,8'aS)-7'-[[tert-butyl(dimethyl)silyl]oxymethyl]-5'-hydroxy-4',4',8'a-trimethylspiro[1,3-dioxolane-4,8'-2,3,4a,5-tetrahydro-1H-naphthalene]-2-one |
| SMILES | CC1(C)CCC[C@@]2(C)[C@H]1[C@H](O)C=C(CO[Si](C)(C)C(C)(C)C)[C@]21COC(=O)O1 |
| InChI | InChI=1S/C22H38O5Si/c1-19(2,3)28(7,8)26-13-15-12-16(23)17-20(4,5)10-9-11-21(17,6)22(15)14-25-18(24)27-22/h12,16-17,23H,9-11,13-14H2,1-8H3/t16-,17+,21+,22-/m1/s1 |
| InChIKey | LSSRQOUWULDZIX-XKPGHWPRSA-N |
| XLogP | 5.05 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|