About benzyl N-(N'-benzyl-N-phenylmethoxycarbonylcarbamimidoyl)carbamate
benzyl N-(N'-benzyl-N-phenylmethoxycarbonylcarbamimidoyl)carbamate (PubChem CID 10835768) has the molecular formula C24H23N3O4
and a molecular weight of 417.47 g/mol. Its IUPAC name is benzyl N-(N'-benzyl-N-phenylmethoxycarbonylcarbamimidoyl)carbamate.
Molecular Properties
| Compound Name | benzyl N-(N'-benzyl-N-phenylmethoxycarbonylcarbamimidoyl)carbamate |
| PubChem CID | 10835768 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | benzyl N-(N'-benzyl-N-phenylmethoxycarbonylcarbamimidoyl)carbamate |
| SMILES | O=C(NC(=NCc1ccccc1)NC(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C24H23N3O4/c28-23(30-17-20-12-6-2-7-13-20)26-22(25-16-19-10-4-1-5-11-19)27-24(29)31-18-21-14-8-3-9-15-21/h1-15H,16-18H2,(H2,25,26,27,28,29) |
| InChIKey | BZLGCNUKBJMRCG-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl N-(N'-benzyl-N-phenylmethoxycarbonylcarbamimidoyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl N-(N'-benzyl-N-phenylmethoxycarbonylcarbamimidoyl)carbamate?
The IUPAC name of benzyl N-(N'-benzyl-N-phenylmethoxycarbonylcarbamimidoyl)carbamate (CID 10835768) is benzyl N-(N'-benzyl-N-phenylmethoxycarbonylcarbamimidoyl)carbamate.
What is the SMILES notation for benzyl N-(N'-benzyl-N-phenylmethoxycarbonylcarbamimidoyl)carbamate?
The canonical SMILES for benzyl N-(N'-benzyl-N-phenylmethoxycarbonylcarbamimidoyl)carbamate is O=C(NC(=NCc1ccccc1)NC(=O)OCc1ccccc1)OCc1ccccc1.
What is the InChIKey of benzyl N-(N'-benzyl-N-phenylmethoxycarbonylcarbamimidoyl)carbamate?
The InChIKey is BZLGCNUKBJMRCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H23N3O4/c28-23(30-17-20-12-6-2-7-13-20)26-22(25-16-19-10-4-1-5-11-19)27-24(29)31-18-21-14-8-3-9-15-21/h1-15H,16-18H2,(H2,25,26,27,28,29).
What are the key properties of benzyl N-(N'-benzyl-N-phenylmethoxycarbonylcarbamimidoyl)carbamate?
benzyl N-(N'-benzyl-N-phenylmethoxycarbonylcarbamimidoyl)carbamate has a molecular weight of 417.47 g/mol, XLogP of 4.40, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl N-(N'-benzyl-N-phenylmethoxycarbonylcarbamimidoyl)carbamate is sourced from PubChem (CID 10835768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).