C25H38O5 — CID 10835832
(3S,3aS,6aS,10S,10aR)-10-hydroxy-7,7-dimethyl-3-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-1-oxo-3a,6,6a,8,9,10-hexahydro-3H-benzo[d][2]benzofuran-4-carbaldehyde (PubChem CID 10835832) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is (3S,3aS,6aS,10S,10aR)-10-hydroxy-7,7-dimethyl-3-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-1-oxo-3a,6,6a,8,9,10-hexahydro-3H-benzo[d][2]benzofuran-4-carbaldehyde.
| Compound Name | (3S,3aS,6aS,10S,10aR)-10-hydroxy-7,7-dimethyl-3-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-1-oxo-3a,6,6a,8,9,10-hexahydro-3H-benzo[d][2]benzofuran-4-carbaldehyde |
|---|---|
| PubChem CID | 10835832 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | (3S,3aS,6aS,10S,10aR)-10-hydroxy-7,7-dimethyl-3-[(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl]oxy-1-oxo-3a,6,6a,8,9,10-hexahydro-3H-benzo[d][2]benzofuran-4-carbaldehyde |
| SMILES | CC(C)[C@H]1CC[C@H](C)C[C@@H]1O[C@H]1OC(=O)[C@@]23[C@@H]1C(C=O)=CC[C@H]2C(C)(C)CC[C@@H]3O |
| InChI | InChI=1S/C25H38O5/c1-14(2)17-8-6-15(3)12-18(17)29-22-21-16(13-26)7-9-19-24(4,5)11-10-20(27)25(19,21)23(28)30-22/h7,13-15,17-22,27H,6,8-12H2,1-5H3/t15-,17+,18-,19-,20-,21+,22-,25-/m0/s1 |
| InChIKey | KFKRYWHGVIPGAG-OTIUCMENSA-N |
| XLogP | 4.28 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|