C24H36F3N3 — CID 10836059
N',N'-diethyl-N-[7-(trifluoromethyl)quinolin-4-yl]decane-1,10-diamine (PubChem CID 10836059) has the molecular formula C24H36F3N3 and a molecular weight of 423.57 g/mol. Its IUPAC name is N',N'-diethyl-N-[7-(trifluoromethyl)quinolin-4-yl]decane-1,10-diamine.
| Compound Name | N',N'-diethyl-N-[7-(trifluoromethyl)quinolin-4-yl]decane-1,10-diamine |
|---|---|
| PubChem CID | 10836059 |
| Molecular Formula | C24H36F3N3 |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | N',N'-diethyl-N-[7-(trifluoromethyl)quinolin-4-yl]decane-1,10-diamine |
| SMILES | CCN(CC)CCCCCCCCCCNc1ccnc2cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C24H36F3N3/c1-3-30(4-2)18-12-10-8-6-5-7-9-11-16-28-22-15-17-29-23-19-20(24(25,26)27)13-14-21(22)23/h13-15,17,19H,3-12,16,18H2,1-2H3,(H,28,29) |
| InChIKey | ZRQWYFREEMWCDV-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|