C24H38O4Si — CID 10836103
3-[deuterio(triethylsilyloxy)methyl]-6-[(1E,7E,9E)-9,10-dideuterioundeca-1,7,9-trienyl]-4-(trideuteriomethoxy)pyran-2-one (PubChem CID 10836103) has the molecular formula C24H38O4Si and a molecular weight of 424.69 g/mol. Its IUPAC name is 3-[deuterio(triethylsilyloxy)methyl]-6-[(1E,7E,9E)-9,10-dideuterioundeca-1,7,9-trienyl]-4-(trideuteriomethoxy)pyran-2-one.
| Compound Name | 3-[deuterio(triethylsilyloxy)methyl]-6-[(1E,7E,9E)-9,10-dideuterioundeca-1,7,9-trienyl]-4-(trideuteriomethoxy)pyran-2-one |
|---|---|
| PubChem CID | 10836103 |
| Molecular Formula | C24H38O4Si |
| Molecular Weight | 424.69 g/mol |
| Exact Mass | 424.29 |
| IUPAC Name | 3-[deuterio(triethylsilyloxy)methyl]-6-[(1E,7E,9E)-9,10-dideuterioundeca-1,7,9-trienyl]-4-(trideuteriomethoxy)pyran-2-one |
| SMILES | [2H]/C(C)=C([2H])\C=C\CCCC/C=C/c1cc(OC([2H])([2H])[2H])c(C([2H])O[Si](CC)(CC)CC)c(=O)o1 |
| InChI | InChI=1S/C24H38O4Si/c1-6-10-11-12-13-14-15-16-17-18-21-19-23(26-5)22(24(25)28-21)20-27-29(7-2,8-3)9-4/h6,10-12,17-19H,7-9,13-16,20H2,1-5H3/b10-6+,12-11+,18-17+/i5D3,6D,10D,20D |
| InChIKey | BYOOMZPTWZVIOX-CHOOTGDPSA-N |
| XLogP | 6.88 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.69 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|