About ditert-butyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate
ditert-butyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate (PubChem CID 10836328) has the molecular formula C21H29F2NO6
and a molecular weight of 429.46 g/mol. Its IUPAC name is ditert-butyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate.
Molecular Properties
| Compound Name | ditert-butyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate |
| PubChem CID | 10836328 |
| Molecular Formula | C21H29F2NO6 |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.20 |
| IUPAC Name | ditert-butyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate |
| SMILES | CC(C)(C)OC(=O)C(CC(F)(F)C(=O)OC(C)(C)C)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C21H29F2NO6/c1-19(2,3)29-16(25)15(12-21(22,23)17(26)30-20(4,5)6)24-18(27)28-13-14-10-8-7-9-11-14/h7-11,15H,12-13H2,1-6H3,(H,24,27) |
| InChIKey | MJDUQRFDBLMGOP-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate?
The IUPAC name of ditert-butyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate (CID 10836328) is ditert-butyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate.
What is the SMILES notation for ditert-butyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate?
The canonical SMILES for ditert-butyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate is CC(C)(C)OC(=O)C(CC(F)(F)C(=O)OC(C)(C)C)NC(=O)OCc1ccccc1.
What is the InChIKey of ditert-butyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate?
The InChIKey is MJDUQRFDBLMGOP-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H29F2NO6/c1-19(2,3)29-16(25)15(12-21(22,23)17(26)30-20(4,5)6)24-18(27)28-13-14-10-8-7-9-11-14/h7-11,15H,12-13H2,1-6H3,(H,24,27).
What are the key properties of ditert-butyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate?
ditert-butyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate has a molecular weight of 429.46 g/mol, XLogP of 3.99, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyl 2,2-difluoro-4-(phenylmethoxycarbonylamino)pentanedioate is sourced from PubChem (CID 10836328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).