About 4-[2-(3,5-difluoro-4-methoxyphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide
4-[2-(3,5-difluoro-4-methoxyphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide (PubChem CID 10836527) has the molecular formula C17H12F5N3O3S
and a molecular weight of 433.36 g/mol. Its IUPAC name is 4-[2-(3,5-difluoro-4-methoxyphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[2-(3,5-difluoro-4-methoxyphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide |
| PubChem CID | 10836527 |
| Molecular Formula | C17H12F5N3O3S |
| Molecular Weight | 433.36 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 4-[2-(3,5-difluoro-4-methoxyphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide |
| SMILES | COc1c(F)cc(-c2nc(C(F)(F)F)cn2-c2ccc(S(N)(=O)=O)cc2)cc1F |
| InChI | InChI=1S/C17H12F5N3O3S/c1-28-15-12(18)6-9(7-13(15)19)16-24-14(17(20,21)22)8-25(16)10-2-4-11(5-3-10)29(23,26)27/h2-8H,1H3,(H2,23,26,27) |
| InChIKey | LCCVBKWYQBQOJT-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.36 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[2-(3,5-difluoro-4-methoxyphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(3,5-difluoro-4-methoxyphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide?
The IUPAC name of 4-[2-(3,5-difluoro-4-methoxyphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide (CID 10836527) is 4-[2-(3,5-difluoro-4-methoxyphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide.
What is the SMILES notation for 4-[2-(3,5-difluoro-4-methoxyphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide?
The canonical SMILES for 4-[2-(3,5-difluoro-4-methoxyphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide is COc1c(F)cc(-c2nc(C(F)(F)F)cn2-c2ccc(S(N)(=O)=O)cc2)cc1F.
What is the InChIKey of 4-[2-(3,5-difluoro-4-methoxyphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide?
The InChIKey is LCCVBKWYQBQOJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F5N3O3S/c1-28-15-12(18)6-9(7-13(15)19)16-24-14(17(20,21)22)8-25(16)10-2-4-11(5-3-10)29(23,26)27/h2-8H,1H3,(H2,23,26,27).
What are the key properties of 4-[2-(3,5-difluoro-4-methoxyphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide?
4-[2-(3,5-difluoro-4-methoxyphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide has a molecular weight of 433.36 g/mol, XLogP of 3.49, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(3,5-difluoro-4-methoxyphenyl)-4-(trifluoromethyl)imidazol-1-yl]benzenesulfonamide is sourced from PubChem (CID 10836527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).