C14H7ClF10N2O — CID 10837029
2-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-8-methylpyrido[1,2-a]pyrimidin-4-one (PubChem CID 10837029) has the molecular formula C14H7ClF10N2O and a molecular weight of 444.66 g/mol. Its IUPAC name is 2-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-8-methylpyrido[1,2-a]pyrimidin-4-one.
| Compound Name | 2-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-8-methylpyrido[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 10837029 |
| Molecular Formula | C14H7ClF10N2O |
| Molecular Weight | 444.66 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | 2-(5-chloro-1,1,2,2,3,3,4,4,5,5-decafluoropentyl)-8-methylpyrido[1,2-a]pyrimidin-4-one |
| SMILES | Cc1ccn2c(=O)cc(C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl)nc2c1 |
| InChI | InChI=1S/C14H7ClF10N2O/c1-6-2-3-27-8(4-6)26-7(5-9(27)28)10(16,17)11(18,19)12(20,21)13(22,23)14(15,24)25/h2-5H,1H3 |
| InChIKey | VRSVYHINUNCQGC-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 34.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.66 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|