C24H22F3NO4 — CID 10837049
(2,3,6-trifluorophenyl) 3,8-dimethoxy-5,10-dimethyl-9,9a-dihydro-4aH-acridine-9-carboxylate (PubChem CID 10837049) has the molecular formula C24H22F3NO4 and a molecular weight of 445.44 g/mol. Its IUPAC name is (2,3,6-trifluorophenyl) 3,8-dimethoxy-5,10-dimethyl-9,9a-dihydro-4aH-acridine-9-carboxylate.
| Compound Name | (2,3,6-trifluorophenyl) 3,8-dimethoxy-5,10-dimethyl-9,9a-dihydro-4aH-acridine-9-carboxylate |
|---|---|
| PubChem CID | 10837049 |
| Molecular Formula | C24H22F3NO4 |
| Molecular Weight | 445.44 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | (2,3,6-trifluorophenyl) 3,8-dimethoxy-5,10-dimethyl-9,9a-dihydro-4aH-acridine-9-carboxylate |
| SMILES | COC1=CC2C(C=C1)C(C(=O)Oc1c(F)ccc(F)c1F)c1c(OC)ccc(C)c1N2C |
| InChI | InChI=1S/C24H22F3NO4/c1-12-5-10-18(31-4)20-19(24(29)32-23-16(26)9-8-15(25)21(23)27)14-7-6-13(30-3)11-17(14)28(2)22(12)20/h5-11,14,17,19H,1-4H3 |
| InChIKey | BWWKVIKLRKGKDG-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|