About CID 10837166
CID 10837166 (PubChem CID 10837166) has the molecular formula C21H31FeNOSe+2
and a molecular weight of 448.29 g/mol.
Molecular Properties
| Compound Name | CID 10837166 |
| PubChem CID | 10837166 |
| Molecular Formula | C21H31FeNOSe+2 |
| Molecular Weight | 448.29 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | — |
| SMILES | CO[C@@]1(C)CCC[C@@H]1[Se][C]1[CH][CH][CH][C]1[C@@H](C)N(C)C.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C16H26NOSe.C5H5.Fe/c1-12(17(3)4)13-8-6-9-14(13)19-15-10-7-11-16(15,2)18-5;1-2-4-5-3-1;/h6,8-9,12,15H,7,10-11H2,1-5H3;1-5H;/q;;+2/t12-,15+,16+;;/m1../s1 |
| InChIKey | JMVVWUPMWGCFKK-YXZBPGINSA-N |
| XLogP | 3.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.29 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 10837166 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 10837166?
The IUPAC name of CID 10837166 (CID 10837166) is not available.
What is the SMILES notation for CID 10837166?
The canonical SMILES for CID 10837166 is CO[C@@]1(C)CCC[C@@H]1[Se][C]1[CH][CH][CH][C]1[C@@H](C)N(C)C.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 10837166?
The InChIKey is JMVVWUPMWGCFKK-YXZBPGINSA-N. The full InChI is InChI=1S/C16H26NOSe.C5H5.Fe/c1-12(17(3)4)13-8-6-9-14(13)19-15-10-7-11-16(15,2)18-5;1-2-4-5-3-1;/h6,8-9,12,15H,7,10-11H2,1-5H3;1-5H;/q;;+2/t12-,15+,16+;;/m1../s1.
What are the key properties of CID 10837166?
CID 10837166 has a molecular weight of 448.29 g/mol, XLogP of 3.77, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 10837166 is sourced from PubChem (CID 10837166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).