C23H27Cl2N3O2 — CID 10837169
7-[4-[4-(2,4-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one (PubChem CID 10837169) has the molecular formula C23H27Cl2N3O2 and a molecular weight of 448.39 g/mol. Its IUPAC name is 7-[4-[4-(2,4-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one.
| Compound Name | 7-[4-[4-(2,4-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
|---|---|
| PubChem CID | 10837169 |
| Molecular Formula | C23H27Cl2N3O2 |
| Molecular Weight | 448.39 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | 7-[4-[4-(2,4-dichlorophenyl)piperazin-1-yl]butoxy]-3,4-dihydro-1H-quinolin-2-one |
| SMILES | O=C1CCc2ccc(OCCCCN3CCN(c4ccc(Cl)cc4Cl)CC3)cc2N1 |
| InChI | InChI=1S/C23H27Cl2N3O2/c24-18-5-7-22(20(25)15-18)28-12-10-27(11-13-28)9-1-2-14-30-19-6-3-17-4-8-23(29)26-21(17)16-19/h3,5-7,15-16H,1-2,4,8-14H2,(H,26,29) |
| InChIKey | JAOOSYMZEJIJJJ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|