About 3,5-dichloro-1-(4-chlorophenyl)-3-phenyl-6-thiophen-2-ylpyridine-2,4-dione
3,5-dichloro-1-(4-chlorophenyl)-3-phenyl-6-thiophen-2-ylpyridine-2,4-dione (PubChem CID 10837194) has the molecular formula C21H12Cl3NO2S
and a molecular weight of 448.76 g/mol. Its IUPAC name is 3,5-dichloro-1-(4-chlorophenyl)-3-phenyl-6-thiophen-2-ylpyridine-2,4-dione.
Molecular Properties
| Compound Name | 3,5-dichloro-1-(4-chlorophenyl)-3-phenyl-6-thiophen-2-ylpyridine-2,4-dione |
| PubChem CID | 10837194 |
| Molecular Formula | C21H12Cl3NO2S |
| Molecular Weight | 448.76 g/mol |
| Exact Mass | 446.97 |
| IUPAC Name | 3,5-dichloro-1-(4-chlorophenyl)-3-phenyl-6-thiophen-2-ylpyridine-2,4-dione |
| SMILES | O=C1C(Cl)=C(c2cccs2)N(c2ccc(Cl)cc2)C(=O)C1(Cl)c1ccccc1 |
| InChI | InChI=1S/C21H12Cl3NO2S/c22-14-8-10-15(11-9-14)25-18(16-7-4-12-28-16)17(23)19(26)21(24,20(25)27)13-5-2-1-3-6-13/h1-12H |
| InChIKey | KKPQDGNTWAKVOL-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.76 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 3,5-dichloro-1-(4-chlorophenyl)-3-phenyl-6-thiophen-2-ylpyridine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dichloro-1-(4-chlorophenyl)-3-phenyl-6-thiophen-2-ylpyridine-2,4-dione?
The IUPAC name of 3,5-dichloro-1-(4-chlorophenyl)-3-phenyl-6-thiophen-2-ylpyridine-2,4-dione (CID 10837194) is 3,5-dichloro-1-(4-chlorophenyl)-3-phenyl-6-thiophen-2-ylpyridine-2,4-dione.
What is the SMILES notation for 3,5-dichloro-1-(4-chlorophenyl)-3-phenyl-6-thiophen-2-ylpyridine-2,4-dione?
The canonical SMILES for 3,5-dichloro-1-(4-chlorophenyl)-3-phenyl-6-thiophen-2-ylpyridine-2,4-dione is O=C1C(Cl)=C(c2cccs2)N(c2ccc(Cl)cc2)C(=O)C1(Cl)c1ccccc1.
What is the InChIKey of 3,5-dichloro-1-(4-chlorophenyl)-3-phenyl-6-thiophen-2-ylpyridine-2,4-dione?
The InChIKey is KKPQDGNTWAKVOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H12Cl3NO2S/c22-14-8-10-15(11-9-14)25-18(16-7-4-12-28-16)17(23)19(26)21(24,20(25)27)13-5-2-1-3-6-13/h1-12H.
What are the key properties of 3,5-dichloro-1-(4-chlorophenyl)-3-phenyl-6-thiophen-2-ylpyridine-2,4-dione?
3,5-dichloro-1-(4-chlorophenyl)-3-phenyl-6-thiophen-2-ylpyridine-2,4-dione has a molecular weight of 448.76 g/mol, XLogP of 6.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dichloro-1-(4-chlorophenyl)-3-phenyl-6-thiophen-2-ylpyridine-2,4-dione is sourced from PubChem (CID 10837194), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).