C28H52O2Si — CID 10837196
(1S,2R,4S)-2-[(1E,3E,5E)-3-methyltrideca-1,3,5-trienyl]-4-tri(propan-2-yl)silyloxycyclopentan-1-ol (PubChem CID 10837196) has the molecular formula C28H52O2Si and a molecular weight of 448.81 g/mol. Its IUPAC name is (1S,2R,4S)-2-[(1E,3E,5E)-3-methyltrideca-1,3,5-trienyl]-4-tri(propan-2-yl)silyloxycyclopentan-1-ol.
| Compound Name | (1S,2R,4S)-2-[(1E,3E,5E)-3-methyltrideca-1,3,5-trienyl]-4-tri(propan-2-yl)silyloxycyclopentan-1-ol |
|---|---|
| PubChem CID | 10837196 |
| Molecular Formula | C28H52O2Si |
| Molecular Weight | 448.81 g/mol |
| Exact Mass | 448.37 |
| IUPAC Name | (1S,2R,4S)-2-[(1E,3E,5E)-3-methyltrideca-1,3,5-trienyl]-4-tri(propan-2-yl)silyloxycyclopentan-1-ol |
| SMILES | CCCCCCC/C=C/C=C(C)/C=C/[C@H]1C[C@H](O[Si](C(C)C)(C(C)C)C(C)C)C[C@@H]1O |
| InChI | InChI=1S/C28H52O2Si/c1-9-10-11-12-13-14-15-16-17-25(8)18-19-26-20-27(21-28(26)29)30-31(22(2)3,23(4)5)24(6)7/h15-19,22-24,26-29H,9-14,20-21H2,1-8H3/b16-15+,19-18+,25-17+/t26-,27-,28-/m0/s1 |
| InChIKey | ZJCDTNQTMIEVBR-PHIQHNNQSA-N |
| XLogP | 8.74 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.81 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|