C22H22Cl2N2O2S — CID 10837207
(E)-3-[2-(2,4-dichlorophenyl)sulfanylphenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide (PubChem CID 10837207) has the molecular formula C22H22Cl2N2O2S and a molecular weight of 449.40 g/mol. Its IUPAC name is (E)-3-[2-(2,4-dichlorophenyl)sulfanylphenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(2,4-dichlorophenyl)sulfanylphenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
|---|---|
| PubChem CID | 10837207 |
| Molecular Formula | C22H22Cl2N2O2S |
| Molecular Weight | 449.40 g/mol |
| Exact Mass | 448.08 |
| IUPAC Name | (E)-3-[2-(2,4-dichlorophenyl)sulfanylphenyl]-N-[3-(2-oxopyrrolidin-1-yl)propyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Sc1ccc(Cl)cc1Cl)NCCCN1CCCC1=O |
| InChI | InChI=1S/C22H22Cl2N2O2S/c23-17-9-10-20(18(24)15-17)29-19-6-2-1-5-16(19)8-11-21(27)25-12-4-14-26-13-3-7-22(26)28/h1-2,5-6,8-11,15H,3-4,7,12-14H2,(H,25,27)/b11-8+ |
| InChIKey | MRRPIOMZRFFWSS-DHZHZOJOSA-N |
| XLogP | 5.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.40 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|