C26H46N2O4 — CID 10837281
2-[(S)-[(4S,5S)-4,5-bis(2,3-dimethylbutan-2-yloxymethyl)-1,3-dioxolan-2-yl]-phenylmethyl]-1,1-dimethylhydrazine (PubChem CID 10837281) has the molecular formula C26H46N2O4 and a molecular weight of 450.66 g/mol. Its IUPAC name is 2-[(S)-[(4S,5S)-4,5-bis(2,3-dimethylbutan-2-yloxymethyl)-1,3-dioxolan-2-yl]-phenylmethyl]-1,1-dimethylhydrazine.
| Compound Name | 2-[(S)-[(4S,5S)-4,5-bis(2,3-dimethylbutan-2-yloxymethyl)-1,3-dioxolan-2-yl]-phenylmethyl]-1,1-dimethylhydrazine |
|---|---|
| PubChem CID | 10837281 |
| Molecular Formula | C26H46N2O4 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | 2-[(S)-[(4S,5S)-4,5-bis(2,3-dimethylbutan-2-yloxymethyl)-1,3-dioxolan-2-yl]-phenylmethyl]-1,1-dimethylhydrazine |
| SMILES | CC(C)C(C)(C)OC[C@@H]1OC([C@@H](NN(C)C)c2ccccc2)O[C@H]1COC(C)(C)C(C)C |
| InChI | InChI=1S/C26H46N2O4/c1-18(2)25(5,6)29-16-21-22(17-30-26(7,8)19(3)4)32-24(31-21)23(27-28(9)10)20-14-12-11-13-15-20/h11-15,18-19,21-24,27H,16-17H2,1-10H3/t21-,22-,23-/m0/s1 |
| InChIKey | QUNVBRQELDJTNK-VABKMULXSA-N |
| XLogP | 4.81 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|