About [4-(4-benzylpiperazine-1-carbonyl)phenyl] 2-(1H-indol-3-yl)acetate
[4-(4-benzylpiperazine-1-carbonyl)phenyl] 2-(1H-indol-3-yl)acetate (PubChem CID 10837383) has the molecular formula C28H27N3O3
and a molecular weight of 453.54 g/mol. Its IUPAC name is [4-(4-benzylpiperazine-1-carbonyl)phenyl] 2-(1H-indol-3-yl)acetate.
Molecular Properties
| Compound Name | [4-(4-benzylpiperazine-1-carbonyl)phenyl] 2-(1H-indol-3-yl)acetate |
| PubChem CID | 10837383 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | [4-(4-benzylpiperazine-1-carbonyl)phenyl] 2-(1H-indol-3-yl)acetate |
| SMILES | O=C(Cc1c[nH]c2ccccc12)Oc1ccc(C(=O)N2CCN(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C28H27N3O3/c32-27(18-23-19-29-26-9-5-4-8-25(23)26)34-24-12-10-22(11-13-24)28(33)31-16-14-30(15-17-31)20-21-6-2-1-3-7-21/h1-13,19,29H,14-18,20H2 |
| InChIKey | WCLZIIRBQXUAIA-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-benzylpiperazine-1-carbonyl)phenyl] 2-(1H-indol-3-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-benzylpiperazine-1-carbonyl)phenyl] 2-(1H-indol-3-yl)acetate?
The IUPAC name of [4-(4-benzylpiperazine-1-carbonyl)phenyl] 2-(1H-indol-3-yl)acetate (CID 10837383) is [4-(4-benzylpiperazine-1-carbonyl)phenyl] 2-(1H-indol-3-yl)acetate.
What is the SMILES notation for [4-(4-benzylpiperazine-1-carbonyl)phenyl] 2-(1H-indol-3-yl)acetate?
The canonical SMILES for [4-(4-benzylpiperazine-1-carbonyl)phenyl] 2-(1H-indol-3-yl)acetate is O=C(Cc1c[nH]c2ccccc12)Oc1ccc(C(=O)N2CCN(Cc3ccccc3)CC2)cc1.
What is the InChIKey of [4-(4-benzylpiperazine-1-carbonyl)phenyl] 2-(1H-indol-3-yl)acetate?
The InChIKey is WCLZIIRBQXUAIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27N3O3/c32-27(18-23-19-29-26-9-5-4-8-25(23)26)34-24-12-10-22(11-13-24)28(33)31-16-14-30(15-17-31)20-21-6-2-1-3-7-21/h1-13,19,29H,14-18,20H2.
What are the key properties of [4-(4-benzylpiperazine-1-carbonyl)phenyl] 2-(1H-indol-3-yl)acetate?
[4-(4-benzylpiperazine-1-carbonyl)phenyl] 2-(1H-indol-3-yl)acetate has a molecular weight of 453.54 g/mol, XLogP of 4.27, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-benzylpiperazine-1-carbonyl)phenyl] 2-(1H-indol-3-yl)acetate is sourced from PubChem (CID 10837383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).