C23H41O7P — CID 10837662
1-dimethoxyphosphoryl-3-[2-[(1E,5E)-9-(hydroxymethyl)-2,6,10-trimethylundeca-1,5-dienyl]-1,3-dioxolan-2-yl]propan-2-one (PubChem CID 10837662) has the molecular formula C23H41O7P and a molecular weight of 460.55 g/mol. Its IUPAC name is 1-dimethoxyphosphoryl-3-[2-[(1E,5E)-9-(hydroxymethyl)-2,6,10-trimethylundeca-1,5-dienyl]-1,3-dioxolan-2-yl]propan-2-one.
| Compound Name | 1-dimethoxyphosphoryl-3-[2-[(1E,5E)-9-(hydroxymethyl)-2,6,10-trimethylundeca-1,5-dienyl]-1,3-dioxolan-2-yl]propan-2-one |
|---|---|
| PubChem CID | 10837662 |
| Molecular Formula | C23H41O7P |
| Molecular Weight | 460.55 g/mol |
| Exact Mass | 460.26 |
| IUPAC Name | 1-dimethoxyphosphoryl-3-[2-[(1E,5E)-9-(hydroxymethyl)-2,6,10-trimethylundeca-1,5-dienyl]-1,3-dioxolan-2-yl]propan-2-one |
| SMILES | COP(=O)(CC(=O)CC1(/C=C(\C)CC/C=C(\C)CCC(CO)C(C)C)OCCO1)OC |
| InChI | InChI=1S/C23H41O7P/c1-18(2)21(16-24)11-10-19(3)8-7-9-20(4)14-23(29-12-13-30-23)15-22(25)17-31(26,27-5)28-6/h8,14,18,21,24H,7,9-13,15-17H2,1-6H3/b19-8+,20-14+ |
| InChIKey | OQZBSCHYSSLKBH-HTPNMXJWSA-N |
| XLogP | 4.89 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.55 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|