C24H41NO8 — CID 10838151
[13-[(2R,3R,4R,5R)-1-acetyl-5-(acetyloxymethyl)-3,4-dihydroxypyrrolidin-2-yl]-4-oxotridecyl] acetate (PubChem CID 10838151) has the molecular formula C24H41NO8 and a molecular weight of 471.59 g/mol. Its IUPAC name is [13-[(2R,3R,4R,5R)-1-acetyl-5-(acetyloxymethyl)-3,4-dihydroxypyrrolidin-2-yl]-4-oxotridecyl] acetate.
| Compound Name | [13-[(2R,3R,4R,5R)-1-acetyl-5-(acetyloxymethyl)-3,4-dihydroxypyrrolidin-2-yl]-4-oxotridecyl] acetate |
|---|---|
| PubChem CID | 10838151 |
| Molecular Formula | C24H41NO8 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.28 |
| IUPAC Name | [13-[(2R,3R,4R,5R)-1-acetyl-5-(acetyloxymethyl)-3,4-dihydroxypyrrolidin-2-yl]-4-oxotridecyl] acetate |
| SMILES | CC(=O)OCCCC(=O)CCCCCCCCC[C@@H]1[C@@H](O)[C@H](O)[C@@H](COC(C)=O)N1C(C)=O |
| InChI | InChI=1S/C24H41NO8/c1-17(26)25-21(23(30)24(31)22(25)16-33-19(3)28)14-10-8-6-4-5-7-9-12-20(29)13-11-15-32-18(2)27/h21-24,30-31H,4-16H2,1-3H3/t21-,22-,23-,24-/m1/s1 |
| InChIKey | LTTIMRYPTALZJY-MOUTVQLLSA-N |
| XLogP | 2.29 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|