C24H28O6S2 — CID 10838324
[(1S,2R,3R,4S,5S,8R,9R,10S,11S,12R)-10-(methylsulfonyloxymethyl)-3-heptacyclo[10.6.1.15,8.02,11.03,10.04,9.013,18]icosa-6,13,15,17-tetraenyl]methyl methanesulfonate (PubChem CID 10838324) has the molecular formula C24H28O6S2 and a molecular weight of 476.62 g/mol. Its IUPAC name is [(1S,2R,3R,4S,5S,8R,9R,10S,11S,12R)-10-(methylsulfonyloxymethyl)-3-heptacyclo[10.6.1.15,8.02,11.03,10.04,9.013,18]icosa-6,13,15,17-tetraenyl]methyl methanesulfonate.
| Compound Name | [(1S,2R,3R,4S,5S,8R,9R,10S,11S,12R)-10-(methylsulfonyloxymethyl)-3-heptacyclo[10.6.1.15,8.02,11.03,10.04,9.013,18]icosa-6,13,15,17-tetraenyl]methyl methanesulfonate |
|---|---|
| PubChem CID | 10838324 |
| Molecular Formula | C24H28O6S2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | [(1S,2R,3R,4S,5S,8R,9R,10S,11S,12R)-10-(methylsulfonyloxymethyl)-3-heptacyclo[10.6.1.15,8.02,11.03,10.04,9.013,18]icosa-6,13,15,17-tetraenyl]methyl methanesulfonate |
| SMILES | CS(=O)(=O)OC[C@@]12[C@@H]3[C@@H]([C@H]4C=C[C@@H]3C4)[C@]1(COS(C)(=O)=O)[C@@H]1[C@H]2[C@@H]2C[C@H]1c1ccccc12 |
| InChI | InChI=1S/C24H28O6S2/c1-31(25,26)29-11-23-19-13-7-8-14(9-13)20(19)24(23,12-30-32(2,27)28)22-18-10-17(21(22)23)15-5-3-4-6-16(15)18/h3-8,13-14,17-22H,9-12H2,1-2H3/t13-,14+,17-,18+,19+,20-,21-,22+,23+,24- |
| InChIKey | DRIUSCKPZPPDKF-UQNKPGOASA-N |
| XLogP | 2.89 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cycloheptane_1', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|