C26H24F3N5O — CID 10838397
1-[[4-(dimethylamino)phenyl]methyl]-1-[[3-(1H-pyrazol-5-yl)phenyl]methyl]-3-(2,4,6-trifluorophenyl)urea (PubChem CID 10838397) has the molecular formula C26H24F3N5O and a molecular weight of 479.51 g/mol. Its IUPAC name is 1-[[4-(dimethylamino)phenyl]methyl]-1-[[3-(1H-pyrazol-5-yl)phenyl]methyl]-3-(2,4,6-trifluorophenyl)urea.
| Compound Name | 1-[[4-(dimethylamino)phenyl]methyl]-1-[[3-(1H-pyrazol-5-yl)phenyl]methyl]-3-(2,4,6-trifluorophenyl)urea |
|---|---|
| PubChem CID | 10838397 |
| Molecular Formula | C26H24F3N5O |
| Molecular Weight | 479.51 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 1-[[4-(dimethylamino)phenyl]methyl]-1-[[3-(1H-pyrazol-5-yl)phenyl]methyl]-3-(2,4,6-trifluorophenyl)urea |
| SMILES | CN(C)c1ccc(CN(Cc2cccc(-c3ccn[nH]3)c2)C(=O)Nc2c(F)cc(F)cc2F)cc1 |
| InChI | InChI=1S/C26H24F3N5O/c1-33(2)21-8-6-17(7-9-21)15-34(26(35)31-25-22(28)13-20(27)14-23(25)29)16-18-4-3-5-19(12-18)24-10-11-30-32-24/h3-14H,15-16H2,1-2H3,(H,30,32)(H,31,35) |
| InChIKey | YKPWIOMOALIGCF-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 64.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.51 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|