C27H50O5Si — CID 10838522
methyl 7-[(1R,2S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(2R,3S)-3-pentyloxirane-2-carbonyl]cyclopentyl]heptanoate (PubChem CID 10838522) has the molecular formula C27H50O5Si and a molecular weight of 482.78 g/mol. Its IUPAC name is methyl 7-[(1R,2S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(2R,3S)-3-pentyloxirane-2-carbonyl]cyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1R,2S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(2R,3S)-3-pentyloxirane-2-carbonyl]cyclopentyl]heptanoate |
|---|---|
| PubChem CID | 10838522 |
| Molecular Formula | C27H50O5Si |
| Molecular Weight | 482.78 g/mol |
| Exact Mass | 482.34 |
| IUPAC Name | methyl 7-[(1R,2S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-5-[(2R,3S)-3-pentyloxirane-2-carbonyl]cyclopentyl]heptanoate |
| SMILES | CCCCC[C@@H]1O[C@H]1C(=O)[C@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C27H50O5Si/c1-8-9-12-16-23-26(31-23)25(29)21-18-19-22(32-33(6,7)27(2,3)4)20(21)15-13-10-11-14-17-24(28)30-5/h20-23,26H,8-19H2,1-7H3/t20-,21+,22+,23+,26-/m1/s1 |
| InChIKey | FQMCBQUWGRKVLO-PTMVLBRKSA-N |
| XLogP | 6.83 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.78 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|