C20H33BrN4O3Si — CID 10838610
N'-[2-[(4-bromophenyl)methylideneamino]ethyl]-N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]ethane-1,2-diamine (PubChem CID 10838610) has the molecular formula C20H33BrN4O3Si and a molecular weight of 485.50 g/mol. Its IUPAC name is N'-[2-[(4-bromophenyl)methylideneamino]ethyl]-N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[(4-bromophenyl)methylideneamino]ethyl]-N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 10838610 |
| Molecular Formula | C20H33BrN4O3Si |
| Molecular Weight | 485.50 g/mol |
| Exact Mass | 484.15 |
| IUPAC Name | N'-[2-[(4-bromophenyl)methylideneamino]ethyl]-N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]ethane-1,2-diamine |
| SMILES | Brc1ccc(/C=N/CCNCCNCCC[Si]23OCCN(CCO2)CCO3)cc1 |
| InChI | InChI=1S/C20H33BrN4O3Si/c21-20-4-2-19(3-5-20)18-24-10-9-23-8-7-22-6-1-17-29-26-14-11-25(12-15-27-29)13-16-28-29/h2-5,18,22-23H,1,6-17H2/b24-18+ |
| InChIKey | WNBZXKDCXXUKPE-HKOYGPOVSA-N |
| XLogP | 1.76 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.50 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|