C20H32ClN5O5Si — CID 10838629
N'-[2-[(2-chloro-3-nitrophenyl)methylideneamino]ethyl]-N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]ethane-1,2-diamine (PubChem CID 10838629) has the molecular formula C20H32ClN5O5Si and a molecular weight of 486.05 g/mol. Its IUPAC name is N'-[2-[(2-chloro-3-nitrophenyl)methylideneamino]ethyl]-N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]ethane-1,2-diamine.
| Compound Name | N'-[2-[(2-chloro-3-nitrophenyl)methylideneamino]ethyl]-N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 10838629 |
| Molecular Formula | C20H32ClN5O5Si |
| Molecular Weight | 486.05 g/mol |
| Exact Mass | 485.19 |
| IUPAC Name | N'-[2-[(2-chloro-3-nitrophenyl)methylideneamino]ethyl]-N-[3-(2,8,9-trioxa-5-aza-1-silabicyclo[3.3.3]undecan-1-yl)propyl]ethane-1,2-diamine |
| SMILES | O=[N+]([O-])c1cccc(/C=N/CCNCCNCCC[Si]23OCCN(CCO2)CCO3)c1Cl |
| InChI | InChI=1S/C20H32ClN5O5Si/c21-20-18(3-1-4-19(20)26(27)28)17-24-9-8-23-7-6-22-5-2-16-32-29-13-10-25(11-14-30-32)12-15-31-32/h1,3-4,17,22-23H,2,5-16H2/b24-17+ |
| InChIKey | SKBZJKXALBAKDA-JJIBRWJFSA-N |
| XLogP | 1.55 |
| TPSA | 110.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.05 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|