C16H8ClF9O3S — CID 10838659
[2-(4-chlorophenyl)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 10838659) has the molecular formula C16H8ClF9O3S and a molecular weight of 486.74 g/mol. Its IUPAC name is [2-(4-chlorophenyl)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [2-(4-chlorophenyl)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 10838659 |
| Molecular Formula | C16H8ClF9O3S |
| Molecular Weight | 486.74 g/mol |
| Exact Mass | 485.97 |
| IUPAC Name | [2-(4-chlorophenyl)phenyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=S(=O)(Oc1ccccc1-c1ccc(Cl)cc1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H8ClF9O3S/c17-10-7-5-9(6-8-10)11-3-1-2-4-12(11)29-30(27,28)16(25,26)14(20,21)13(18,19)15(22,23)24/h1-8H |
| InChIKey | IHHVAOJDKXCSLE-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.74 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|