C29H29N5O3 — CID 10838957
1-(3-cyanophenyl)-3-[1-(3,3-dimethylbutyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]urea (PubChem CID 10838957) has the molecular formula C29H29N5O3 and a molecular weight of 495.58 g/mol. Its IUPAC name is 1-(3-cyanophenyl)-3-[1-(3,3-dimethylbutyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]urea.
| Compound Name | 1-(3-cyanophenyl)-3-[1-(3,3-dimethylbutyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]urea |
|---|---|
| PubChem CID | 10838957 |
| Molecular Formula | C29H29N5O3 |
| Molecular Weight | 495.58 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 1-(3-cyanophenyl)-3-[1-(3,3-dimethylbutyl)-2,4-dioxo-5-phenyl-1,5-benzodiazepin-3-yl]urea |
| SMILES | CC(C)(C)CCN1C(=O)C(NC(=O)Nc2cccc(C#N)c2)C(=O)N(c2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C29H29N5O3/c1-29(2,3)16-17-33-23-14-7-8-15-24(23)34(22-12-5-4-6-13-22)27(36)25(26(33)35)32-28(37)31-21-11-9-10-20(18-21)19-30/h4-15,18,25H,16-17H2,1-3H3,(H2,31,32,37) |
| InChIKey | PYTRLTXRAFPIME-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 105.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|