About 3-(2-methylpiperidin-1-yl)propyl 4-cyclohexyloxybenzoate
3-(2-methylpiperidin-1-yl)propyl 4-cyclohexyloxybenzoate (PubChem CID 10839) has the molecular formula C22H33NO3
and a molecular weight of 359.51 g/mol. Its IUPAC name is 3-(2-methylpiperidin-1-yl)propyl 4-cyclohexyloxybenzoate.
Molecular Properties
| Compound Name | 3-(2-methylpiperidin-1-yl)propyl 4-cyclohexyloxybenzoate |
| PubChem CID | 10839 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 3-(2-methylpiperidin-1-yl)propyl 4-cyclohexyloxybenzoate |
| SMILES | CC1CCCCN1CCCOC(=O)c1ccc(OC2CCCCC2)cc1 |
| InChI | InChI=1S/C22H33NO3/c1-18-8-5-6-15-23(18)16-7-17-25-22(24)19-11-13-21(14-12-19)26-20-9-3-2-4-10-20/h11-14,18,20H,2-10,15-17H2,1H3 |
| InChIKey | YLRNESBGEGGQBK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-methylpiperidin-1-yl)propyl 4-cyclohexyloxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-methylpiperidin-1-yl)propyl 4-cyclohexyloxybenzoate?
The IUPAC name of 3-(2-methylpiperidin-1-yl)propyl 4-cyclohexyloxybenzoate (CID 10839) is 3-(2-methylpiperidin-1-yl)propyl 4-cyclohexyloxybenzoate.
What is the SMILES notation for 3-(2-methylpiperidin-1-yl)propyl 4-cyclohexyloxybenzoate?
The canonical SMILES for 3-(2-methylpiperidin-1-yl)propyl 4-cyclohexyloxybenzoate is CC1CCCCN1CCCOC(=O)c1ccc(OC2CCCCC2)cc1.
What is the InChIKey of 3-(2-methylpiperidin-1-yl)propyl 4-cyclohexyloxybenzoate?
The InChIKey is YLRNESBGEGGQBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H33NO3/c1-18-8-5-6-15-23(18)16-7-17-25-22(24)19-11-13-21(14-12-19)26-20-9-3-2-4-10-20/h11-14,18,20H,2-10,15-17H2,1H3.
What are the key properties of 3-(2-methylpiperidin-1-yl)propyl 4-cyclohexyloxybenzoate?
3-(2-methylpiperidin-1-yl)propyl 4-cyclohexyloxybenzoate has a molecular weight of 359.51 g/mol, XLogP of 4.82, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-methylpiperidin-1-yl)propyl 4-cyclohexyloxybenzoate is sourced from PubChem (CID 10839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).