C31H40O6 — CID 10839380
methyl (1S,4aR,5S,8aR)-5-[2-(5,8-diacetyloxy-1,4-dihydronaphthalen-2-yl)ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate (PubChem CID 10839380) has the molecular formula C31H40O6 and a molecular weight of 508.66 g/mol. Its IUPAC name is methyl (1S,4aR,5S,8aR)-5-[2-(5,8-diacetyloxy-1,4-dihydronaphthalen-2-yl)ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate.
| Compound Name | methyl (1S,4aR,5S,8aR)-5-[2-(5,8-diacetyloxy-1,4-dihydronaphthalen-2-yl)ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 10839380 |
| Molecular Formula | C31H40O6 |
| Molecular Weight | 508.66 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | methyl (1S,4aR,5S,8aR)-5-[2-(5,8-diacetyloxy-1,4-dihydronaphthalen-2-yl)ethyl]-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylate |
| SMILES | C=C1CC[C@@H]2[C@](C)(CCC[C@]2(C)C(=O)OC)[C@H]1CCC1=CCc2c(OC(C)=O)ccc(OC(C)=O)c2C1 |
| InChI | InChI=1S/C31H40O6/c1-19-8-15-28-30(4,16-7-17-31(28,5)29(34)35-6)25(19)12-10-22-9-11-23-24(18-22)27(37-21(3)33)14-13-26(23)36-20(2)32/h9,13-14,25,28H,1,7-8,10-12,15-18H2,2-6H3/t25-,28+,30+,31-/m0/s1 |
| InChIKey | GJDWHPPJRZHPLZ-YXWCJEOBSA-N |
| XLogP | 6.29 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.66 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|