C25H54O5Si3 — CID 10839661
(5R)-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]oxolan-2-one (PubChem CID 10839661) has the molecular formula C25H54O5Si3 and a molecular weight of 518.96 g/mol. Its IUPAC name is (5R)-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]oxolan-2-one.
| Compound Name | (5R)-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]oxolan-2-one |
|---|---|
| PubChem CID | 10839661 |
| Molecular Formula | C25H54O5Si3 |
| Molecular Weight | 518.96 g/mol |
| Exact Mass | 518.33 |
| IUPAC Name | (5R)-5-[(1S,2R)-1,2,3-tris[[tert-butyl(dimethyl)silyl]oxy]propyl]oxolan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1CCC(=O)O1 |
| InChI | InChI=1S/C25H54O5Si3/c1-23(2,3)31(10,11)27-18-20(29-32(12,13)24(4,5)6)22(19-16-17-21(26)28-19)30-33(14,15)25(7,8)9/h19-20,22H,16-18H2,1-15H3/t19-,20-,22+/m1/s1 |
| InChIKey | HEGURFZYBLIJIM-SJBKTWHCSA-N |
| XLogP | 7.49 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.96 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|