C34H34O5 — CID 10839754
3,8-bis[(4-hydroxyphenyl)methyl]-7-methoxy-1-(3-methylbut-2-enyl)-9,10-dihydrophenanthrene-2,5-diol (PubChem CID 10839754) has the molecular formula C34H34O5 and a molecular weight of 522.64 g/mol. Its IUPAC name is 3,8-bis[(4-hydroxyphenyl)methyl]-7-methoxy-1-(3-methylbut-2-enyl)-9,10-dihydrophenanthrene-2,5-diol.
| Compound Name | 3,8-bis[(4-hydroxyphenyl)methyl]-7-methoxy-1-(3-methylbut-2-enyl)-9,10-dihydrophenanthrene-2,5-diol |
|---|---|
| PubChem CID | 10839754 |
| Molecular Formula | C34H34O5 |
| Molecular Weight | 522.64 g/mol |
| Exact Mass | 522.24 |
| IUPAC Name | 3,8-bis[(4-hydroxyphenyl)methyl]-7-methoxy-1-(3-methylbut-2-enyl)-9,10-dihydrophenanthrene-2,5-diol |
| SMILES | COc1cc(O)c2c(c1Cc1ccc(O)cc1)CCc1c-2cc(Cc2ccc(O)cc2)c(O)c1CC=C(C)C |
| InChI | InChI=1S/C34H34O5/c1-20(2)4-13-28-26-14-15-27-29(17-22-7-11-25(36)12-8-22)32(39-3)19-31(37)33(27)30(26)18-23(34(28)38)16-21-5-9-24(35)10-6-21/h4-12,18-19,35-38H,13-17H2,1-3H3 |
| InChIKey | RLRFDQCBCXUXFC-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.64 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|