C29H36O4Se — CID 10839879
(3S,4R,5R)-3-[(E,1S)-1-hydroxy-3-phenylprop-2-enyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-phenylselanyloxolan-2-one (PubChem CID 10839879) has the molecular formula C29H36O4Se and a molecular weight of 527.56 g/mol. Its IUPAC name is (3S,4R,5R)-3-[(E,1S)-1-hydroxy-3-phenylprop-2-enyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-phenylselanyloxolan-2-one.
| Compound Name | (3S,4R,5R)-3-[(E,1S)-1-hydroxy-3-phenylprop-2-enyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-phenylselanyloxolan-2-one |
|---|---|
| PubChem CID | 10839879 |
| Molecular Formula | C29H36O4Se |
| Molecular Weight | 527.56 g/mol |
| Exact Mass | 528.18 |
| IUPAC Name | (3S,4R,5R)-3-[(E,1S)-1-hydroxy-3-phenylprop-2-enyl]-5-[(1R,2S,5R)-5-methyl-2-propan-2-ylcyclohexyl]oxy-4-phenylselanyloxolan-2-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@H]1O[C@@H]1OC(=O)[C@H]([C@@H](O)/C=C/c2ccccc2)[C@H]1[Se]c1ccccc1 |
| InChI | InChI=1S/C29H36O4Se/c1-19(2)23-16-14-20(3)18-25(23)32-29-27(34-22-12-8-5-9-13-22)26(28(31)33-29)24(30)17-15-21-10-6-4-7-11-21/h4-13,15,17,19-20,23-27,29-30H,14,16,18H2,1-3H3/b17-15+/t20-,23+,24+,25-,26-,27-,29-/m1/s1 |
| InChIKey | URZITJPLIKXYCW-HQHLIALNSA-N |
| XLogP | 4.86 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.56 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|